C23H30O4 — CID 66728253
2-[(E)-3,7-dimethyloct-2-enyl]-6,7-dimethoxy-3-methylnaphthalene-1,4-dione (PubChem CID 66728253) has the molecular formula C23H30O4 and a molecular weight of 370.49 g/mol. Its IUPAC name is 2-[(E)-3,7-dimethyloct-2-enyl]-6,7-dimethoxy-3-methylnaphthalene-1,4-dione.
| Compound Name | 2-[(E)-3,7-dimethyloct-2-enyl]-6,7-dimethoxy-3-methylnaphthalene-1,4-dione |
|---|---|
| PubChem CID | 66728253 |
| Molecular Formula | C23H30O4 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | 2-[(E)-3,7-dimethyloct-2-enyl]-6,7-dimethoxy-3-methylnaphthalene-1,4-dione |
| SMILES | COc1cc2c(cc1OC)C(=O)C(C/C=C(\C)CCCC(C)C)=C(C)C2=O |
| InChI | InChI=1S/C23H30O4/c1-14(2)8-7-9-15(3)10-11-17-16(4)22(24)18-12-20(26-5)21(27-6)13-19(18)23(17)25/h10,12-14H,7-9,11H2,1-6H3/b15-10+ |
| InChIKey | CTMGTOSGYIEFON-XNTDXEJSSA-N |
| XLogP | 5.56 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|