C10H13Cl3N2O3 — CID 66728713
2,2,2-trichloroethyl N-(3-tert-butyl-1,2-oxazol-5-yl)carbamate (PubChem CID 66728713) has the molecular formula C10H13Cl3N2O3 and a molecular weight of 315.58 g/mol. Its IUPAC name is 2,2,2-trichloroethyl N-(3-tert-butyl-1,2-oxazol-5-yl)carbamate.
| Compound Name | 2,2,2-trichloroethyl N-(3-tert-butyl-1,2-oxazol-5-yl)carbamate |
|---|---|
| PubChem CID | 66728713 |
| Molecular Formula | C10H13Cl3N2O3 |
| Molecular Weight | 315.58 g/mol |
| Exact Mass | 314.00 |
| IUPAC Name | 2,2,2-trichloroethyl N-(3-tert-butyl-1,2-oxazol-5-yl)carbamate |
| SMILES | CC(C)(C)c1cc(NC(=O)OCC(Cl)(Cl)Cl)on1 |
| InChI | InChI=1S/C10H13Cl3N2O3/c1-9(2,3)6-4-7(18-15-6)14-8(16)17-5-10(11,12)13/h4H,5H2,1-3H3,(H,14,16) |
| InChIKey | CIVCNCIPJLNYCP-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.58 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|