About adamantan-1-ol;azane
adamantan-1-ol;azane (PubChem CID 66728775) has the molecular formula C10H19NO
and a molecular weight of 169.27 g/mol. Its IUPAC name is adamantan-1-ol;azane.
Molecular Properties
| Compound Name | adamantan-1-ol;azane |
| PubChem CID | 66728775 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | adamantan-1-ol;azane |
| SMILES | N.OC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C10H16O.H3N/c11-10-4-7-1-8(5-10)3-9(2-7)6-10;/h7-9,11H,1-6H2;1H3 |
| InChIKey | FHPLFAFJUCGDTI-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 55.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze adamantan-1-ol;azane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of adamantan-1-ol;azane?
The IUPAC name of adamantan-1-ol;azane (CID 66728775) is adamantan-1-ol;azane.
What is the SMILES notation for adamantan-1-ol;azane?
The canonical SMILES for adamantan-1-ol;azane is N.OC12CC3CC(CC(C3)C1)C2.
What is the InChIKey of adamantan-1-ol;azane?
The InChIKey is FHPLFAFJUCGDTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O.H3N/c11-10-4-7-1-8(5-10)3-9(2-7)6-10;/h7-9,11H,1-6H2;1H3.
What are the key properties of adamantan-1-ol;azane?
adamantan-1-ol;azane has a molecular weight of 169.27 g/mol, XLogP of 2.11, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for adamantan-1-ol;azane is sourced from PubChem (CID 66728775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).