C8H10N2O3 — CID 66728930
1,3-diazaspiro[4.5]decane-2,4,8-trione (PubChem CID 66728930) has the molecular formula C8H10N2O3 and a molecular weight of 182.18 g/mol. Its IUPAC name is 1,3-diazaspiro[4.5]decane-2,4,8-trione.
| Compound Name | 1,3-diazaspiro[4.5]decane-2,4,8-trione |
|---|---|
| PubChem CID | 66728930 |
| Molecular Formula | C8H10N2O3 |
| Molecular Weight | 182.18 g/mol |
| Exact Mass | 182.07 |
| IUPAC Name | 1,3-diazaspiro[4.5]decane-2,4,8-trione |
| SMILES | O=C1CCC2(CC1)NC(=O)NC2=O |
| InChI | InChI=1S/C8H10N2O3/c11-5-1-3-8(4-2-5)6(12)9-7(13)10-8/h1-4H2,(H2,9,10,12,13) |
| InChIKey | IVSBWJVHDCWNQR-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.18 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|