About 6-(6,6-dimethylcyclohex-2-en-1-yl)-2H-pyran-3-ol
6-(6,6-dimethylcyclohex-2-en-1-yl)-2H-pyran-3-ol (PubChem CID 66729156) has the molecular formula C13H18O2
and a molecular weight of 206.28 g/mol. Its IUPAC name is 6-(6,6-dimethylcyclohex-2-en-1-yl)-2H-pyran-3-ol.
Molecular Properties
| Compound Name | 6-(6,6-dimethylcyclohex-2-en-1-yl)-2H-pyran-3-ol |
| PubChem CID | 66729156 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | 6-(6,6-dimethylcyclohex-2-en-1-yl)-2H-pyran-3-ol |
| SMILES | CC1(C)CCC=CC1C1=CC=C(O)CO1 |
| InChI | InChI=1S/C13H18O2/c1-13(2)8-4-3-5-11(13)12-7-6-10(14)9-15-12/h3,5-7,11,14H,4,8-9H2,1-2H3 |
| InChIKey | CHFWSYXXEHGFEF-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-(6,6-dimethylcyclohex-2-en-1-yl)-2H-pyran-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(6,6-dimethylcyclohex-2-en-1-yl)-2H-pyran-3-ol?
The IUPAC name of 6-(6,6-dimethylcyclohex-2-en-1-yl)-2H-pyran-3-ol (CID 66729156) is 6-(6,6-dimethylcyclohex-2-en-1-yl)-2H-pyran-3-ol.
What is the SMILES notation for 6-(6,6-dimethylcyclohex-2-en-1-yl)-2H-pyran-3-ol?
The canonical SMILES for 6-(6,6-dimethylcyclohex-2-en-1-yl)-2H-pyran-3-ol is CC1(C)CCC=CC1C1=CC=C(O)CO1.
What is the InChIKey of 6-(6,6-dimethylcyclohex-2-en-1-yl)-2H-pyran-3-ol?
The InChIKey is CHFWSYXXEHGFEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O2/c1-13(2)8-4-3-5-11(13)12-7-6-10(14)9-15-12/h3,5-7,11,14H,4,8-9H2,1-2H3.
What are the key properties of 6-(6,6-dimethylcyclohex-2-en-1-yl)-2H-pyran-3-ol?
6-(6,6-dimethylcyclohex-2-en-1-yl)-2H-pyran-3-ol has a molecular weight of 206.28 g/mol, XLogP of 3.33, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(6,6-dimethylcyclohex-2-en-1-yl)-2H-pyran-3-ol is sourced from PubChem (CID 66729156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).