C34H35F3N6O5S — CID 66729473
tert-butyl 4-[3-[3-[(2,5-difluorophenyl)sulfonylmethoxymethylamino]-2-fluorophenyl]-4-(1H-pyrrolo[2,3-b]pyridin-4-yl)pyrazol-1-yl]piperidine-1-carboxylate (PubChem CID 66729473) has the molecular formula C34H35F3N6O5S and a molecular weight of 696.75 g/mol. Its IUPAC name is tert-butyl 4-[3-[3-[(2,5-difluorophenyl)sulfonylmethoxymethylamino]-2-fluorophenyl]-4-(1H-pyrrolo[2,3-b]pyridin-4-yl)pyrazol-1-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-[3-[(2,5-difluorophenyl)sulfonylmethoxymethylamino]-2-fluorophenyl]-4-(1H-pyrrolo[2,3-b]pyridin-4-yl)pyrazol-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 66729473 |
| Molecular Formula | C34H35F3N6O5S |
| Molecular Weight | 696.75 g/mol |
| Exact Mass | 696.23 |
| IUPAC Name | tert-butyl 4-[3-[3-[(2,5-difluorophenyl)sulfonylmethoxymethylamino]-2-fluorophenyl]-4-(1H-pyrrolo[2,3-b]pyridin-4-yl)pyrazol-1-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(n2cc(-c3ccnc4[nH]ccc34)c(-c3cccc(NCOCS(=O)(=O)c4cc(F)ccc4F)c3F)n2)CC1 |
| InChI | InChI=1S/C34H35F3N6O5S/c1-34(2,3)48-33(44)42-15-11-22(12-16-42)43-18-26(23-9-13-38-32-24(23)10-14-39-32)31(41-43)25-5-4-6-28(30(25)37)40-19-47-20-49(45,46)29-17-21(35)7-8-27(29)36/h4-10,13-14,17-18,22,40H,11-12,15-16,19-20H2,1-3H3,(H,38,39) |
| InChIKey | AWNPWQFXFVEMEA-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 131.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.75 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|