C11H21N3 — CID 66729518
3,3,7,7-tetramethyl-4,6,8,9-tetrahydro-2H-pyrimido[1,2-a]pyrimidine (PubChem CID 66729518) has the molecular formula C11H21N3 and a molecular weight of 195.31 g/mol. Its IUPAC name is 3,3,7,7-tetramethyl-4,6,8,9-tetrahydro-2H-pyrimido[1,2-a]pyrimidine.
| Compound Name | 3,3,7,7-tetramethyl-4,6,8,9-tetrahydro-2H-pyrimido[1,2-a]pyrimidine |
|---|---|
| PubChem CID | 66729518 |
| Molecular Formula | C11H21N3 |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.17 |
| IUPAC Name | 3,3,7,7-tetramethyl-4,6,8,9-tetrahydro-2H-pyrimido[1,2-a]pyrimidine |
| SMILES | CC1(C)CN=C2NCC(C)(C)CN2C1 |
| InChI | InChI=1S/C11H21N3/c1-10(2)5-12-9-13-6-11(3,4)8-14(9)7-10/h5-8H2,1-4H3,(H,12,13) |
| InChIKey | HMWZPUGIBJYLLO-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |