About 3,3-diethyl-4,5-dihydro-2H-pyrimidin-3-ium
3,3-diethyl-4,5-dihydro-2H-pyrimidin-3-ium (PubChem CID 66729695) has the molecular formula C8H17N2+
and a molecular weight of 141.24 g/mol. Its IUPAC name is 3,3-diethyl-4,5-dihydro-2H-pyrimidin-3-ium.
Molecular Properties
| Compound Name | 3,3-diethyl-4,5-dihydro-2H-pyrimidin-3-ium |
| PubChem CID | 66729695 |
| Molecular Formula | C8H17N2+ |
| Molecular Weight | 141.24 g/mol |
| Exact Mass | 141.14 |
| IUPAC Name | 3,3-diethyl-4,5-dihydro-2H-pyrimidin-3-ium |
| SMILES | CC[N+]1(CC)CCC=NC1 |
| InChI | InChI=1S/C8H17N2/c1-3-10(4-2)7-5-6-9-8-10/h6H,3-5,7-8H2,1-2H3/q+1 |
| InChIKey | MFSUIESSGLOZIL-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.24 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 3,3-diethyl-4,5-dihydro-2H-pyrimidin-3-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-diethyl-4,5-dihydro-2H-pyrimidin-3-ium?
The IUPAC name of 3,3-diethyl-4,5-dihydro-2H-pyrimidin-3-ium (CID 66729695) is 3,3-diethyl-4,5-dihydro-2H-pyrimidin-3-ium.
What is the SMILES notation for 3,3-diethyl-4,5-dihydro-2H-pyrimidin-3-ium?
The canonical SMILES for 3,3-diethyl-4,5-dihydro-2H-pyrimidin-3-ium is CC[N+]1(CC)CCC=NC1.
What is the InChIKey of 3,3-diethyl-4,5-dihydro-2H-pyrimidin-3-ium?
The InChIKey is MFSUIESSGLOZIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N2/c1-3-10(4-2)7-5-6-9-8-10/h6H,3-5,7-8H2,1-2H3/q+1.
What are the key properties of 3,3-diethyl-4,5-dihydro-2H-pyrimidin-3-ium?
3,3-diethyl-4,5-dihydro-2H-pyrimidin-3-ium has a molecular weight of 141.24 g/mol, XLogP of 1.27, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-diethyl-4,5-dihydro-2H-pyrimidin-3-ium is sourced from PubChem (CID 66729695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).