About 1,3-diethyl-2,4-dihydropyrimidine
1,3-diethyl-2,4-dihydropyrimidine (PubChem CID 66729696) has the molecular formula C8H16N2
and a molecular weight of 140.23 g/mol. Its IUPAC name is 1,3-diethyl-2,4-dihydropyrimidine.
Molecular Properties
| Compound Name | 1,3-diethyl-2,4-dihydropyrimidine |
| PubChem CID | 66729696 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | 1,3-diethyl-2,4-dihydropyrimidine |
| SMILES | CCN1C=CCN(CC)C1 |
| InChI | InChI=1S/C8H16N2/c1-3-9-6-5-7-10(4-2)8-9/h5-6H,3-4,7-8H2,1-2H3 |
| InChIKey | KSTMTOKQIFRQFU-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,3-diethyl-2,4-dihydropyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-diethyl-2,4-dihydropyrimidine?
The IUPAC name of 1,3-diethyl-2,4-dihydropyrimidine (CID 66729696) is 1,3-diethyl-2,4-dihydropyrimidine.
What is the SMILES notation for 1,3-diethyl-2,4-dihydropyrimidine?
The canonical SMILES for 1,3-diethyl-2,4-dihydropyrimidine is CCN1C=CCN(CC)C1.
What is the InChIKey of 1,3-diethyl-2,4-dihydropyrimidine?
The InChIKey is KSTMTOKQIFRQFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2/c1-3-9-6-5-7-10(4-2)8-9/h5-6H,3-4,7-8H2,1-2H3.
What are the key properties of 1,3-diethyl-2,4-dihydropyrimidine?
1,3-diethyl-2,4-dihydropyrimidine has a molecular weight of 140.23 g/mol, XLogP of 1.12, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-diethyl-2,4-dihydropyrimidine is sourced from PubChem (CID 66729696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).