About [cyclohexyl(2,2,2-trifluoroethyl)phosphoryl]oxycyclohexane
[cyclohexyl(2,2,2-trifluoroethyl)phosphoryl]oxycyclohexane (PubChem CID 66729721) has the molecular formula C14H24F3O2P
and a molecular weight of 312.31 g/mol. Its IUPAC name is [cyclohexyl(2,2,2-trifluoroethyl)phosphoryl]oxycyclohexane.
Molecular Properties
| Compound Name | [cyclohexyl(2,2,2-trifluoroethyl)phosphoryl]oxycyclohexane |
| PubChem CID | 66729721 |
| Molecular Formula | C14H24F3O2P |
| Molecular Weight | 312.31 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | [cyclohexyl(2,2,2-trifluoroethyl)phosphoryl]oxycyclohexane |
| SMILES | O=P(CC(F)(F)F)(OC1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C14H24F3O2P/c15-14(16,17)11-20(18,13-9-5-2-6-10-13)19-12-7-3-1-4-8-12/h12-13H,1-11H2 |
| InChIKey | CXETWESVQKKUTI-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 312.31 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [cyclohexyl(2,2,2-trifluoroethyl)phosphoryl]oxycyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [cyclohexyl(2,2,2-trifluoroethyl)phosphoryl]oxycyclohexane?
The IUPAC name of [cyclohexyl(2,2,2-trifluoroethyl)phosphoryl]oxycyclohexane (CID 66729721) is [cyclohexyl(2,2,2-trifluoroethyl)phosphoryl]oxycyclohexane.
What is the SMILES notation for [cyclohexyl(2,2,2-trifluoroethyl)phosphoryl]oxycyclohexane?
The canonical SMILES for [cyclohexyl(2,2,2-trifluoroethyl)phosphoryl]oxycyclohexane is O=P(CC(F)(F)F)(OC1CCCCC1)C1CCCCC1.
What is the InChIKey of [cyclohexyl(2,2,2-trifluoroethyl)phosphoryl]oxycyclohexane?
The InChIKey is CXETWESVQKKUTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24F3O2P/c15-14(16,17)11-20(18,13-9-5-2-6-10-13)19-12-7-3-1-4-8-12/h12-13H,1-11H2.
What are the key properties of [cyclohexyl(2,2,2-trifluoroethyl)phosphoryl]oxycyclohexane?
[cyclohexyl(2,2,2-trifluoroethyl)phosphoryl]oxycyclohexane has a molecular weight of 312.31 g/mol, XLogP of 5.51, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [cyclohexyl(2,2,2-trifluoroethyl)phosphoryl]oxycyclohexane is sourced from PubChem (CID 66729721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).