C5H7F3S — CID 66729807
2,3,5-trifluoro-4-methylthiolane (PubChem CID 66729807) has the molecular formula C5H7F3S and a molecular weight of 156.17 g/mol. Its IUPAC name is 2,3,5-trifluoro-4-methylthiolane.
| Compound Name | 2,3,5-trifluoro-4-methylthiolane |
|---|---|
| PubChem CID | 66729807 |
| Molecular Formula | C5H7F3S |
| Molecular Weight | 156.17 g/mol |
| Exact Mass | 156.02 |
| IUPAC Name | 2,3,5-trifluoro-4-methylthiolane |
| SMILES | CC1C(F)SC(F)C1F |
| InChI | InChI=1S/C5H7F3S/c1-2-3(6)5(8)9-4(2)7/h2-5H,1H3 |
| InChIKey | MCQLMKFVENDCNN-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.17 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |