C9H17N3O2 — CID 66730110
9,9-dimethyl-1,4,7-triazecane-8,10-dione (PubChem CID 66730110) has the molecular formula C9H17N3O2 and a molecular weight of 199.25 g/mol. Its IUPAC name is 9,9-dimethyl-1,4,7-triazecane-8,10-dione.
| Compound Name | 9,9-dimethyl-1,4,7-triazecane-8,10-dione |
|---|---|
| PubChem CID | 66730110 |
| Molecular Formula | C9H17N3O2 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.13 |
| IUPAC Name | 9,9-dimethyl-1,4,7-triazecane-8,10-dione |
| SMILES | CC1(C)C(=O)NCCNCCNC1=O |
| InChI | InChI=1S/C9H17N3O2/c1-9(2)7(13)11-5-3-10-4-6-12-8(9)14/h10H,3-6H2,1-2H3,(H,11,13)(H,12,14) |
| InChIKey | HBUITEARHYSLIK-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|