C19H28BNO2 — CID 66730394
3-[[4-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]phenyl]methyl]pyrrolidine (PubChem CID 66730394) has the molecular formula C19H28BNO2 and a molecular weight of 313.25 g/mol. Its IUPAC name is 3-[[4-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]phenyl]methyl]pyrrolidine.
| Compound Name | 3-[[4-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]phenyl]methyl]pyrrolidine |
|---|---|
| PubChem CID | 66730394 |
| Molecular Formula | C19H28BNO2 |
| Molecular Weight | 313.25 g/mol |
| Exact Mass | 313.22 |
| IUPAC Name | 3-[[4-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]phenyl]methyl]pyrrolidine |
| SMILES | CC1(C)OB(/C=C/c2ccc(CC3CCNC3)cc2)OC1(C)C |
| InChI | InChI=1S/C19H28BNO2/c1-18(2)19(3,4)23-20(22-18)11-9-15-5-7-16(8-6-15)13-17-10-12-21-14-17/h5-9,11,17,21H,10,12-14H2,1-4H3/b11-9+ |
| InChIKey | MUFSCEQJQIUZTL-PKNBQFBNSA-N |
| XLogP | 3.48 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.25 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|