About 2-[bis(2-hydroxyethoxy)amino]oxyethanol;1-methylpyrrolidin-2-one
2-[bis(2-hydroxyethoxy)amino]oxyethanol;1-methylpyrrolidin-2-one (PubChem CID 66730630) has the molecular formula C11H24N2O7
and a molecular weight of 296.32 g/mol. Its IUPAC name is 2-[bis(2-hydroxyethoxy)amino]oxyethanol;1-methylpyrrolidin-2-one.
Molecular Properties
| Compound Name | 2-[bis(2-hydroxyethoxy)amino]oxyethanol;1-methylpyrrolidin-2-one |
| PubChem CID | 66730630 |
| Molecular Formula | C11H24N2O7 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | 2-[bis(2-hydroxyethoxy)amino]oxyethanol;1-methylpyrrolidin-2-one |
| SMILES | CN1CCCC1=O.OCCON(OCCO)OCCO |
| InChI | InChI=1S/C6H15NO6.C5H9NO/c8-1-4-11-7(12-5-2-9)13-6-3-10;1-6-4-2-3-5(6)7/h8-10H,1-6H2;2-4H2,1H3 |
| InChIKey | LAYWHOJIQPKHNH-UHFFFAOYSA-N |
| XLogP | -1.70 |
| TPSA | 111.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[bis(2-hydroxyethoxy)amino]oxyethanol;1-methylpyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[bis(2-hydroxyethoxy)amino]oxyethanol;1-methylpyrrolidin-2-one?
The IUPAC name of 2-[bis(2-hydroxyethoxy)amino]oxyethanol;1-methylpyrrolidin-2-one (CID 66730630) is 2-[bis(2-hydroxyethoxy)amino]oxyethanol;1-methylpyrrolidin-2-one.
What is the SMILES notation for 2-[bis(2-hydroxyethoxy)amino]oxyethanol;1-methylpyrrolidin-2-one?
The canonical SMILES for 2-[bis(2-hydroxyethoxy)amino]oxyethanol;1-methylpyrrolidin-2-one is CN1CCCC1=O.OCCON(OCCO)OCCO.
What is the InChIKey of 2-[bis(2-hydroxyethoxy)amino]oxyethanol;1-methylpyrrolidin-2-one?
The InChIKey is LAYWHOJIQPKHNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15NO6.C5H9NO/c8-1-4-11-7(12-5-2-9)13-6-3-10;1-6-4-2-3-5(6)7/h8-10H,1-6H2;2-4H2,1H3.
What are the key properties of 2-[bis(2-hydroxyethoxy)amino]oxyethanol;1-methylpyrrolidin-2-one?
2-[bis(2-hydroxyethoxy)amino]oxyethanol;1-methylpyrrolidin-2-one has a molecular weight of 296.32 g/mol, XLogP of -1.70, 9 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[bis(2-hydroxyethoxy)amino]oxyethanol;1-methylpyrrolidin-2-one is sourced from PubChem (CID 66730630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).