C27H30F3N3O4S — CID 66730658
tert-butyl 6-cyclopropyl-2-[5-[prop-2-enyl(1,1,1-trifluoropropan-2-yl)sulfamoyl]-2-pyridinyl]indole-1-carboxylate (PubChem CID 66730658) has the molecular formula C27H30F3N3O4S and a molecular weight of 549.62 g/mol. Its IUPAC name is tert-butyl 6-cyclopropyl-2-[5-[prop-2-enyl(1,1,1-trifluoropropan-2-yl)sulfamoyl]-2-pyridinyl]indole-1-carboxylate.
| Compound Name | tert-butyl 6-cyclopropyl-2-[5-[prop-2-enyl(1,1,1-trifluoropropan-2-yl)sulfamoyl]-2-pyridinyl]indole-1-carboxylate |
|---|---|
| PubChem CID | 66730658 |
| Molecular Formula | C27H30F3N3O4S |
| Molecular Weight | 549.62 g/mol |
| Exact Mass | 549.19 |
| IUPAC Name | tert-butyl 6-cyclopropyl-2-[5-[prop-2-enyl(1,1,1-trifluoropropan-2-yl)sulfamoyl]-2-pyridinyl]indole-1-carboxylate |
| SMILES | C=CCN(C(C)C(F)(F)F)S(=O)(=O)c1ccc(-c2cc3ccc(C4CC4)cc3n2C(=O)OC(C)(C)C)nc1 |
| InChI | InChI=1S/C27H30F3N3O4S/c1-6-13-32(17(2)27(28,29)30)38(35,36)21-11-12-22(31-16-21)24-15-20-10-9-19(18-7-8-18)14-23(20)33(24)25(34)37-26(3,4)5/h6,9-12,14-18H,1,7-8,13H2,2-5H3 |
| InChIKey | AEZPYQBBZKAHOP-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.62 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|