C18H12N2O5S — CID 667307
3-[2-[[5-(2-methylfuran-3-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]chromen-2-one (PubChem CID 667307) has the molecular formula C18H12N2O5S and a molecular weight of 368.37 g/mol. Its IUPAC name is 3-[2-[[5-(2-methylfuran-3-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]chromen-2-one.
| Compound Name | 3-[2-[[5-(2-methylfuran-3-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]chromen-2-one |
|---|---|
| PubChem CID | 667307 |
| Molecular Formula | C18H12N2O5S |
| Molecular Weight | 368.37 g/mol |
| Exact Mass | 368.05 |
| IUPAC Name | 3-[2-[[5-(2-methylfuran-3-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]chromen-2-one |
| SMILES | Cc1occc1-c1nnc(SCC(=O)c2cc3ccccc3oc2=O)o1 |
| InChI | InChI=1S/C18H12N2O5S/c1-10-12(6-7-23-10)16-19-20-18(25-16)26-9-14(21)13-8-11-4-2-3-5-15(11)24-17(13)22/h2-8H,9H2,1H3 |
| InChIKey | REPLRRBUVZFLSM-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 99.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.37 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|