C14H14F3NO4 — CID 66731649
1-methoxycarbonyl-2-(3,4,5-trifluorophenyl)piperidine-4-carboxylic acid (PubChem CID 66731649) has the molecular formula C14H14F3NO4 and a molecular weight of 317.26 g/mol. Its IUPAC name is 1-methoxycarbonyl-2-(3,4,5-trifluorophenyl)piperidine-4-carboxylic acid.
| Compound Name | 1-methoxycarbonyl-2-(3,4,5-trifluorophenyl)piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 66731649 |
| Molecular Formula | C14H14F3NO4 |
| Molecular Weight | 317.26 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | 1-methoxycarbonyl-2-(3,4,5-trifluorophenyl)piperidine-4-carboxylic acid |
| SMILES | COC(=O)N1CCC(C(=O)O)CC1c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C14H14F3NO4/c1-22-14(21)18-3-2-7(13(19)20)6-11(18)8-4-9(15)12(17)10(16)5-8/h4-5,7,11H,2-3,6H2,1H3,(H,19,20) |
| InChIKey | DVZFFJUFTBJHBB-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.26 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|