C15H13F3N2O4 — CID 66731654
4-(3-oxo-1,2-oxazol-5-yl)-2-(2,4,5-trifluorophenyl)piperidine-1-carboxylic acid (PubChem CID 66731654) has the molecular formula C15H13F3N2O4 and a molecular weight of 342.27 g/mol. Its IUPAC name is 4-(3-oxo-1,2-oxazol-5-yl)-2-(2,4,5-trifluorophenyl)piperidine-1-carboxylic acid.
| Compound Name | 4-(3-oxo-1,2-oxazol-5-yl)-2-(2,4,5-trifluorophenyl)piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 66731654 |
| Molecular Formula | C15H13F3N2O4 |
| Molecular Weight | 342.27 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | 4-(3-oxo-1,2-oxazol-5-yl)-2-(2,4,5-trifluorophenyl)piperidine-1-carboxylic acid |
| SMILES | O=C(O)N1CCC(c2cc(=O)[nH]o2)CC1c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C15H13F3N2O4/c16-9-5-11(18)10(17)4-8(9)12-3-7(1-2-20(12)15(22)23)13-6-14(21)19-24-13/h4-7,12H,1-3H2,(H,19,21)(H,22,23) |
| InChIKey | LOBPEKIOMNMLKB-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 86.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.27 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|