About methyl 4-(3-oxo-1,2-oxazol-5-yl)-2-[3-(trifluoromethyl)phenyl]piperidine-1-carboxylate
methyl 4-(3-oxo-1,2-oxazol-5-yl)-2-[3-(trifluoromethyl)phenyl]piperidine-1-carboxylate (PubChem CID 66731750) has the molecular formula C17H17F3N2O4
and a molecular weight of 370.33 g/mol. Its IUPAC name is methyl 4-(3-oxo-1,2-oxazol-5-yl)-2-[3-(trifluoromethyl)phenyl]piperidine-1-carboxylate.
Molecular Properties
| Compound Name | methyl 4-(3-oxo-1,2-oxazol-5-yl)-2-[3-(trifluoromethyl)phenyl]piperidine-1-carboxylate |
| PubChem CID | 66731750 |
| Molecular Formula | C17H17F3N2O4 |
| Molecular Weight | 370.33 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | methyl 4-(3-oxo-1,2-oxazol-5-yl)-2-[3-(trifluoromethyl)phenyl]piperidine-1-carboxylate |
| SMILES | COC(=O)N1CCC(c2cc(=O)[nH]o2)CC1c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H17F3N2O4/c1-25-16(24)22-6-5-11(14-9-15(23)21-26-14)8-13(22)10-3-2-4-12(7-10)17(18,19)20/h2-4,7,9,11,13H,5-6,8H2,1H3,(H,21,23) |
| InChIKey | DCFQGSIPLTYFRJ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 75.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.33 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 4-(3-oxo-1,2-oxazol-5-yl)-2-[3-(trifluoromethyl)phenyl]piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-(3-oxo-1,2-oxazol-5-yl)-2-[3-(trifluoromethyl)phenyl]piperidine-1-carboxylate?
The IUPAC name of methyl 4-(3-oxo-1,2-oxazol-5-yl)-2-[3-(trifluoromethyl)phenyl]piperidine-1-carboxylate (CID 66731750) is methyl 4-(3-oxo-1,2-oxazol-5-yl)-2-[3-(trifluoromethyl)phenyl]piperidine-1-carboxylate.
What is the SMILES notation for methyl 4-(3-oxo-1,2-oxazol-5-yl)-2-[3-(trifluoromethyl)phenyl]piperidine-1-carboxylate?
The canonical SMILES for methyl 4-(3-oxo-1,2-oxazol-5-yl)-2-[3-(trifluoromethyl)phenyl]piperidine-1-carboxylate is COC(=O)N1CCC(c2cc(=O)[nH]o2)CC1c1cccc(C(F)(F)F)c1.
What is the InChIKey of methyl 4-(3-oxo-1,2-oxazol-5-yl)-2-[3-(trifluoromethyl)phenyl]piperidine-1-carboxylate?
The InChIKey is DCFQGSIPLTYFRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17F3N2O4/c1-25-16(24)22-6-5-11(14-9-15(23)21-26-14)8-13(22)10-3-2-4-12(7-10)17(18,19)20/h2-4,7,9,11,13H,5-6,8H2,1H3,(H,21,23).
What are the key properties of methyl 4-(3-oxo-1,2-oxazol-5-yl)-2-[3-(trifluoromethyl)phenyl]piperidine-1-carboxylate?
methyl 4-(3-oxo-1,2-oxazol-5-yl)-2-[3-(trifluoromethyl)phenyl]piperidine-1-carboxylate has a molecular weight of 370.33 g/mol, XLogP of 3.67, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(3-oxo-1,2-oxazol-5-yl)-2-[3-(trifluoromethyl)phenyl]piperidine-1-carboxylate is sourced from PubChem (CID 66731750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).