About 3-chloro-4-(2-oxo-1,3-diazinan-1-yl)benzonitrile
3-chloro-4-(2-oxo-1,3-diazinan-1-yl)benzonitrile (PubChem CID 66731945) has the molecular formula C11H10ClN3O
and a molecular weight of 235.67 g/mol. Its IUPAC name is 3-chloro-4-(2-oxo-1,3-diazinan-1-yl)benzonitrile.
Molecular Properties
| Compound Name | 3-chloro-4-(2-oxo-1,3-diazinan-1-yl)benzonitrile |
| PubChem CID | 66731945 |
| Molecular Formula | C11H10ClN3O |
| Molecular Weight | 235.67 g/mol |
| Exact Mass | 235.05 |
| IUPAC Name | 3-chloro-4-(2-oxo-1,3-diazinan-1-yl)benzonitrile |
| SMILES | N#Cc1ccc(N2CCCNC2=O)c(Cl)c1 |
| InChI | InChI=1S/C11H10ClN3O/c12-9-6-8(7-13)2-3-10(9)15-5-1-4-14-11(15)16/h2-3,6H,1,4-5H2,(H,14,16) |
| InChIKey | BPXGCYFZKKGNRN-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.67 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-chloro-4-(2-oxo-1,3-diazinan-1-yl)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-4-(2-oxo-1,3-diazinan-1-yl)benzonitrile?
The IUPAC name of 3-chloro-4-(2-oxo-1,3-diazinan-1-yl)benzonitrile (CID 66731945) is 3-chloro-4-(2-oxo-1,3-diazinan-1-yl)benzonitrile.
What is the SMILES notation for 3-chloro-4-(2-oxo-1,3-diazinan-1-yl)benzonitrile?
The canonical SMILES for 3-chloro-4-(2-oxo-1,3-diazinan-1-yl)benzonitrile is N#Cc1ccc(N2CCCNC2=O)c(Cl)c1.
What is the InChIKey of 3-chloro-4-(2-oxo-1,3-diazinan-1-yl)benzonitrile?
The InChIKey is BPXGCYFZKKGNRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10ClN3O/c12-9-6-8(7-13)2-3-10(9)15-5-1-4-14-11(15)16/h2-3,6H,1,4-5H2,(H,14,16).
What are the key properties of 3-chloro-4-(2-oxo-1,3-diazinan-1-yl)benzonitrile?
3-chloro-4-(2-oxo-1,3-diazinan-1-yl)benzonitrile has a molecular weight of 235.67 g/mol, XLogP of 2.13, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-4-(2-oxo-1,3-diazinan-1-yl)benzonitrile is sourced from PubChem (CID 66731945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).