C37H34F2N8O — CID 66731947
N-[4-[[3-[2-[3-(3,3-difluoropiperidin-1-yl)propylamino]pyrimidin-4-yl]-2-pyridinyl]oxy]phenyl]-4-phenylphthalazin-1-amine (PubChem CID 66731947) has the molecular formula C37H34F2N8O and a molecular weight of 644.73 g/mol. Its IUPAC name is N-[4-[[3-[2-[3-(3,3-difluoropiperidin-1-yl)propylamino]pyrimidin-4-yl]-2-pyridinyl]oxy]phenyl]-4-phenylphthalazin-1-amine.
| Compound Name | N-[4-[[3-[2-[3-(3,3-difluoropiperidin-1-yl)propylamino]pyrimidin-4-yl]-2-pyridinyl]oxy]phenyl]-4-phenylphthalazin-1-amine |
|---|---|
| PubChem CID | 66731947 |
| Molecular Formula | C37H34F2N8O |
| Molecular Weight | 644.73 g/mol |
| Exact Mass | 644.28 |
| IUPAC Name | N-[4-[[3-[2-[3-(3,3-difluoropiperidin-1-yl)propylamino]pyrimidin-4-yl]-2-pyridinyl]oxy]phenyl]-4-phenylphthalazin-1-amine |
| SMILES | FC1(F)CCCN(CCCNc2nccc(-c3cccnc3Oc3ccc(Nc4nnc(-c5ccccc5)c5ccccc45)cc3)n2)C1 |
| InChI | InChI=1S/C37H34F2N8O/c38-37(39)19-7-23-47(25-37)24-8-21-41-36-42-22-18-32(44-36)31-13-6-20-40-35(31)48-28-16-14-27(15-17-28)43-34-30-12-5-4-11-29(30)33(45-46-34)26-9-2-1-3-10-26/h1-6,9-18,20,22H,7-8,19,21,23-25H2,(H,43,46)(H,41,42,44) |
| InChIKey | SFWQVKIHCPUVBZ-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.73 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|