C15H17FN2O2 — CID 66732202
5-[(2R,4S)-2-[(3-fluorophenyl)methyl]piperidin-4-yl]-1,2-oxazol-3-one (PubChem CID 66732202) has the molecular formula C15H17FN2O2 and a molecular weight of 276.31 g/mol. Its IUPAC name is 5-[(2R,4S)-2-[(3-fluorophenyl)methyl]piperidin-4-yl]-1,2-oxazol-3-one.
| Compound Name | 5-[(2R,4S)-2-[(3-fluorophenyl)methyl]piperidin-4-yl]-1,2-oxazol-3-one |
|---|---|
| PubChem CID | 66732202 |
| Molecular Formula | C15H17FN2O2 |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | 5-[(2R,4S)-2-[(3-fluorophenyl)methyl]piperidin-4-yl]-1,2-oxazol-3-one |
| SMILES | O=c1cc([C@H]2CCN[C@@H](Cc3cccc(F)c3)C2)o[nH]1 |
| InChI | InChI=1S/C15H17FN2O2/c16-12-3-1-2-10(6-12)7-13-8-11(4-5-17-13)14-9-15(19)18-20-14/h1-3,6,9,11,13,17H,4-5,7-8H2,(H,18,19)/t11-,13-/m0/s1 |
| InChIKey | GQBSOTILFRHBGN-AAEUAGOBSA-N |
| XLogP | 2.19 |
| TPSA | 58.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |