C30H38N2O6Si — CID 66732326
3-[(3,4-dimethoxyphenyl)methyl]-6-(2-hydroxy-5-trimethylsilylpent-4-yn-2-yl)-1-(oxan-4-yl)quinazoline-2,4-dione (PubChem CID 66732326) has the molecular formula C30H38N2O6Si and a molecular weight of 550.73 g/mol. Its IUPAC name is 3-[(3,4-dimethoxyphenyl)methyl]-6-(2-hydroxy-5-trimethylsilylpent-4-yn-2-yl)-1-(oxan-4-yl)quinazoline-2,4-dione.
| Compound Name | 3-[(3,4-dimethoxyphenyl)methyl]-6-(2-hydroxy-5-trimethylsilylpent-4-yn-2-yl)-1-(oxan-4-yl)quinazoline-2,4-dione |
|---|---|
| PubChem CID | 66732326 |
| Molecular Formula | C30H38N2O6Si |
| Molecular Weight | 550.73 g/mol |
| Exact Mass | 550.25 |
| IUPAC Name | 3-[(3,4-dimethoxyphenyl)methyl]-6-(2-hydroxy-5-trimethylsilylpent-4-yn-2-yl)-1-(oxan-4-yl)quinazoline-2,4-dione |
| SMILES | COc1ccc(Cn2c(=O)c3cc(C(C)(O)CC#C[Si](C)(C)C)ccc3n(C3CCOCC3)c2=O)cc1OC |
| InChI | InChI=1S/C30H38N2O6Si/c1-30(35,14-7-17-39(4,5)6)22-9-10-25-24(19-22)28(33)31(29(34)32(25)23-12-15-38-16-13-23)20-21-8-11-26(36-2)27(18-21)37-3/h8-11,18-19,23,35H,12-16,20H2,1-6H3 |
| InChIKey | AEYIZQDWJZICOJ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.73 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|