About 5-[2-(2,4-dichlorophenyl)-1-methylpiperidin-4-yl]-1,2-oxazol-3-one
5-[2-(2,4-dichlorophenyl)-1-methylpiperidin-4-yl]-1,2-oxazol-3-one (PubChem CID 66732565) has the molecular formula C15H16Cl2N2O2
and a molecular weight of 327.21 g/mol. Its IUPAC name is 5-[2-(2,4-dichlorophenyl)-1-methylpiperidin-4-yl]-1,2-oxazol-3-one.
Molecular Properties
| Compound Name | 5-[2-(2,4-dichlorophenyl)-1-methylpiperidin-4-yl]-1,2-oxazol-3-one |
| PubChem CID | 66732565 |
| Molecular Formula | C15H16Cl2N2O2 |
| Molecular Weight | 327.21 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | 5-[2-(2,4-dichlorophenyl)-1-methylpiperidin-4-yl]-1,2-oxazol-3-one |
| SMILES | CN1CCC(c2cc(=O)[nH]o2)CC1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H16Cl2N2O2/c1-19-5-4-9(14-8-15(20)18-21-14)6-13(19)11-3-2-10(16)7-12(11)17/h2-3,7-9,13H,4-6H2,1H3,(H,18,20) |
| InChIKey | TVAUKKFSRDSOMS-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 49.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.21 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[2-(2,4-dichlorophenyl)-1-methylpiperidin-4-yl]-1,2-oxazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-(2,4-dichlorophenyl)-1-methylpiperidin-4-yl]-1,2-oxazol-3-one?
The IUPAC name of 5-[2-(2,4-dichlorophenyl)-1-methylpiperidin-4-yl]-1,2-oxazol-3-one (CID 66732565) is 5-[2-(2,4-dichlorophenyl)-1-methylpiperidin-4-yl]-1,2-oxazol-3-one.
What is the SMILES notation for 5-[2-(2,4-dichlorophenyl)-1-methylpiperidin-4-yl]-1,2-oxazol-3-one?
The canonical SMILES for 5-[2-(2,4-dichlorophenyl)-1-methylpiperidin-4-yl]-1,2-oxazol-3-one is CN1CCC(c2cc(=O)[nH]o2)CC1c1ccc(Cl)cc1Cl.
What is the InChIKey of 5-[2-(2,4-dichlorophenyl)-1-methylpiperidin-4-yl]-1,2-oxazol-3-one?
The InChIKey is TVAUKKFSRDSOMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16Cl2N2O2/c1-19-5-4-9(14-8-15(20)18-21-14)6-13(19)11-3-2-10(16)7-12(11)17/h2-3,7-9,13H,4-6H2,1H3,(H,18,20).
What are the key properties of 5-[2-(2,4-dichlorophenyl)-1-methylpiperidin-4-yl]-1,2-oxazol-3-one?
5-[2-(2,4-dichlorophenyl)-1-methylpiperidin-4-yl]-1,2-oxazol-3-one has a molecular weight of 327.21 g/mol, XLogP of 3.83, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-(2,4-dichlorophenyl)-1-methylpiperidin-4-yl]-1,2-oxazol-3-one is sourced from PubChem (CID 66732565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).