About 1-butyl-5-(5-oxa-6-azaspiro[3.4]oct-6-en-7-yl)-N-(oxan-4-yl)pyrazolo[3,4-b]pyridin-4-amine
1-butyl-5-(5-oxa-6-azaspiro[3.4]oct-6-en-7-yl)-N-(oxan-4-yl)pyrazolo[3,4-b]pyridin-4-amine (PubChem CID 66732575) has the molecular formula C21H29N5O2
and a molecular weight of 383.50 g/mol. Its IUPAC name is 1-butyl-5-(5-oxa-6-azaspiro[3.4]oct-6-en-7-yl)-N-(oxan-4-yl)pyrazolo[3,4-b]pyridin-4-amine.
Molecular Properties
| Compound Name | 1-butyl-5-(5-oxa-6-azaspiro[3.4]oct-6-en-7-yl)-N-(oxan-4-yl)pyrazolo[3,4-b]pyridin-4-amine |
| PubChem CID | 66732575 |
| Molecular Formula | C21H29N5O2 |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.23 |
| IUPAC Name | 1-butyl-5-(5-oxa-6-azaspiro[3.4]oct-6-en-7-yl)-N-(oxan-4-yl)pyrazolo[3,4-b]pyridin-4-amine |
| SMILES | CCCCn1ncc2c(NC3CCOCC3)c(C3=NOC4(CCC4)C3)cnc21 |
| InChI | InChI=1S/C21H29N5O2/c1-2-3-9-26-20-17(14-23-26)19(24-15-5-10-27-11-6-15)16(13-22-20)18-12-21(28-25-18)7-4-8-21/h13-15H,2-12H2,1H3,(H,22,24) |
| InChIKey | XQRAHBXMZNTQMW-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 73.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-butyl-5-(5-oxa-6-azaspiro[3.4]oct-6-en-7-yl)-N-(oxan-4-yl)pyrazolo[3,4-b]pyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-5-(5-oxa-6-azaspiro[3.4]oct-6-en-7-yl)-N-(oxan-4-yl)pyrazolo[3,4-b]pyridin-4-amine?
The IUPAC name of 1-butyl-5-(5-oxa-6-azaspiro[3.4]oct-6-en-7-yl)-N-(oxan-4-yl)pyrazolo[3,4-b]pyridin-4-amine (CID 66732575) is 1-butyl-5-(5-oxa-6-azaspiro[3.4]oct-6-en-7-yl)-N-(oxan-4-yl)pyrazolo[3,4-b]pyridin-4-amine.
What is the SMILES notation for 1-butyl-5-(5-oxa-6-azaspiro[3.4]oct-6-en-7-yl)-N-(oxan-4-yl)pyrazolo[3,4-b]pyridin-4-amine?
The canonical SMILES for 1-butyl-5-(5-oxa-6-azaspiro[3.4]oct-6-en-7-yl)-N-(oxan-4-yl)pyrazolo[3,4-b]pyridin-4-amine is CCCCn1ncc2c(NC3CCOCC3)c(C3=NOC4(CCC4)C3)cnc21.
What is the InChIKey of 1-butyl-5-(5-oxa-6-azaspiro[3.4]oct-6-en-7-yl)-N-(oxan-4-yl)pyrazolo[3,4-b]pyridin-4-amine?
The InChIKey is XQRAHBXMZNTQMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H29N5O2/c1-2-3-9-26-20-17(14-23-26)19(24-15-5-10-27-11-6-15)16(13-22-20)18-12-21(28-25-18)7-4-8-21/h13-15H,2-12H2,1H3,(H,22,24).
What are the key properties of 1-butyl-5-(5-oxa-6-azaspiro[3.4]oct-6-en-7-yl)-N-(oxan-4-yl)pyrazolo[3,4-b]pyridin-4-amine?
1-butyl-5-(5-oxa-6-azaspiro[3.4]oct-6-en-7-yl)-N-(oxan-4-yl)pyrazolo[3,4-b]pyridin-4-amine has a molecular weight of 383.50 g/mol, XLogP of 3.87, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-5-(5-oxa-6-azaspiro[3.4]oct-6-en-7-yl)-N-(oxan-4-yl)pyrazolo[3,4-b]pyridin-4-amine is sourced from PubChem (CID 66732575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).