About 2,3,5,6-tetramethylpyrazine;trihydrate
2,3,5,6-tetramethylpyrazine;trihydrate (PubChem CID 66732985) has the molecular formula C8H18N2O3
and a molecular weight of 190.24 g/mol. Its IUPAC name is 2,3,5,6-tetramethylpyrazine;trihydrate.
Molecular Properties
| Compound Name | 2,3,5,6-tetramethylpyrazine;trihydrate |
| PubChem CID | 66732985 |
| Molecular Formula | C8H18N2O3 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.13 |
| IUPAC Name | 2,3,5,6-tetramethylpyrazine;trihydrate |
| SMILES | Cc1nc(C)c(C)nc1C.O.O.O |
| InChI | InChI=1S/C8H12N2.3H2O/c1-5-6(2)10-8(4)7(3)9-5;;;/h1-4H3;3*1H2 |
| InChIKey | MAAZDFZETNADTQ-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 120.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,3,5,6-tetramethylpyrazine;trihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,5,6-tetramethylpyrazine;trihydrate?
The IUPAC name of 2,3,5,6-tetramethylpyrazine;trihydrate (CID 66732985) is 2,3,5,6-tetramethylpyrazine;trihydrate.
What is the SMILES notation for 2,3,5,6-tetramethylpyrazine;trihydrate?
The canonical SMILES for 2,3,5,6-tetramethylpyrazine;trihydrate is Cc1nc(C)c(C)nc1C.O.O.O.
What is the InChIKey of 2,3,5,6-tetramethylpyrazine;trihydrate?
The InChIKey is MAAZDFZETNADTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2.3H2O/c1-5-6(2)10-8(4)7(3)9-5;;;/h1-4H3;3*1H2.
What are the key properties of 2,3,5,6-tetramethylpyrazine;trihydrate?
2,3,5,6-tetramethylpyrazine;trihydrate has a molecular weight of 190.24 g/mol, XLogP of -0.76, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,5,6-tetramethylpyrazine;trihydrate is sourced from PubChem (CID 66732985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).