C31H45BrN6O3Si2 — CID 66733274
6-bromo-5-morpholin-4-yl-3-quinolin-3-yl-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine (PubChem CID 66733274) has the molecular formula C31H45BrN6O3Si2 and a molecular weight of 685.82 g/mol. Its IUPAC name is 6-bromo-5-morpholin-4-yl-3-quinolin-3-yl-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 6-bromo-5-morpholin-4-yl-3-quinolin-3-yl-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 66733274 |
| Molecular Formula | C31H45BrN6O3Si2 |
| Molecular Weight | 685.82 g/mol |
| Exact Mass | 684.23 |
| IUPAC Name | 6-bromo-5-morpholin-4-yl-3-quinolin-3-yl-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine |
| SMILES | C[Si](C)(C)CCOCN(COCC[Si](C)(C)C)c1c(Br)c(N2CCOCC2)nc2c(-c3cnc4ccccc4c3)cnn12 |
| InChI | InChI=1S/C31H45BrN6O3Si2/c1-42(2,3)17-15-40-22-37(23-41-16-18-43(4,5)6)31-28(32)30(36-11-13-39-14-12-36)35-29-26(21-34-38(29)31)25-19-24-9-7-8-10-27(24)33-20-25/h7-10,19-21H,11-18,22-23H2,1-6H3 |
| InChIKey | TUEWKAALOGOEOW-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 77.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.82 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|