C27H38ClN5O2Si2 — CID 66733571
2-chloro-3-quinolin-3-yl-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine (PubChem CID 66733571) has the molecular formula C27H38ClN5O2Si2 and a molecular weight of 556.26 g/mol. Its IUPAC name is 2-chloro-3-quinolin-3-yl-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 2-chloro-3-quinolin-3-yl-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 66733571 |
| Molecular Formula | C27H38ClN5O2Si2 |
| Molecular Weight | 556.26 g/mol |
| Exact Mass | 555.23 |
| IUPAC Name | 2-chloro-3-quinolin-3-yl-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine |
| SMILES | C[Si](C)(C)CCOCN(COCC[Si](C)(C)C)c1ccnc2c(-c3cnc4ccccc4c3)c(Cl)nn12 |
| InChI | InChI=1S/C27H38ClN5O2Si2/c1-36(2,3)15-13-34-19-32(20-35-14-16-37(4,5)6)24-11-12-29-27-25(26(28)31-33(24)27)22-17-21-9-7-8-10-23(21)30-18-22/h7-12,17-18H,13-16,19-20H2,1-6H3 |
| InChIKey | KPMMZVRQZFIBLX-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 64.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.26 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|