About 6-hydroxy-9-[2-(piperazine-1-carbonyl)phenyl]-4,9-dihydroxanthen-3-one
6-hydroxy-9-[2-(piperazine-1-carbonyl)phenyl]-4,9-dihydroxanthen-3-one (PubChem CID 66733658) has the molecular formula C24H22N2O4
and a molecular weight of 402.45 g/mol. Its IUPAC name is 6-hydroxy-9-[2-(piperazine-1-carbonyl)phenyl]-4,9-dihydroxanthen-3-one.
Molecular Properties
| Compound Name | 6-hydroxy-9-[2-(piperazine-1-carbonyl)phenyl]-4,9-dihydroxanthen-3-one |
| PubChem CID | 66733658 |
| Molecular Formula | C24H22N2O4 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | 6-hydroxy-9-[2-(piperazine-1-carbonyl)phenyl]-4,9-dihydroxanthen-3-one |
| SMILES | O=C1C=CC2=C(C1)Oc1cc(O)ccc1C2c1ccccc1C(=O)N1CCNCC1 |
| InChI | InChI=1S/C24H22N2O4/c27-15-5-7-19-21(13-15)30-22-14-16(28)6-8-20(22)23(19)17-3-1-2-4-18(17)24(29)26-11-9-25-10-12-26/h1-8,13,23,25,27H,9-12,14H2 |
| InChIKey | TTZHPBNUYQQDGT-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-hydroxy-9-[2-(piperazine-1-carbonyl)phenyl]-4,9-dihydroxanthen-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydroxy-9-[2-(piperazine-1-carbonyl)phenyl]-4,9-dihydroxanthen-3-one?
The IUPAC name of 6-hydroxy-9-[2-(piperazine-1-carbonyl)phenyl]-4,9-dihydroxanthen-3-one (CID 66733658) is 6-hydroxy-9-[2-(piperazine-1-carbonyl)phenyl]-4,9-dihydroxanthen-3-one.
What is the SMILES notation for 6-hydroxy-9-[2-(piperazine-1-carbonyl)phenyl]-4,9-dihydroxanthen-3-one?
The canonical SMILES for 6-hydroxy-9-[2-(piperazine-1-carbonyl)phenyl]-4,9-dihydroxanthen-3-one is O=C1C=CC2=C(C1)Oc1cc(O)ccc1C2c1ccccc1C(=O)N1CCNCC1.
What is the InChIKey of 6-hydroxy-9-[2-(piperazine-1-carbonyl)phenyl]-4,9-dihydroxanthen-3-one?
The InChIKey is TTZHPBNUYQQDGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H22N2O4/c27-15-5-7-19-21(13-15)30-22-14-16(28)6-8-20(22)23(19)17-3-1-2-4-18(17)24(29)26-11-9-25-10-12-26/h1-8,13,23,25,27H,9-12,14H2.
What are the key properties of 6-hydroxy-9-[2-(piperazine-1-carbonyl)phenyl]-4,9-dihydroxanthen-3-one?
6-hydroxy-9-[2-(piperazine-1-carbonyl)phenyl]-4,9-dihydroxanthen-3-one has a molecular weight of 402.45 g/mol, XLogP of 2.74, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydroxy-9-[2-(piperazine-1-carbonyl)phenyl]-4,9-dihydroxanthen-3-one is sourced from PubChem (CID 66733658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).