C42H52O4S — CID 66733688
(2S,3R,4R,5S,6R)-2-methyl-6-phenylsulfanyl-3,4,5-tris[(2,4,6-trimethylphenyl)methoxy]oxane (PubChem CID 66733688) has the molecular formula C42H52O4S and a molecular weight of 652.94 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-methyl-6-phenylsulfanyl-3,4,5-tris[(2,4,6-trimethylphenyl)methoxy]oxane.
| Compound Name | (2S,3R,4R,5S,6R)-2-methyl-6-phenylsulfanyl-3,4,5-tris[(2,4,6-trimethylphenyl)methoxy]oxane |
|---|---|
| PubChem CID | 66733688 |
| Molecular Formula | C42H52O4S |
| Molecular Weight | 652.94 g/mol |
| Exact Mass | 652.36 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-methyl-6-phenylsulfanyl-3,4,5-tris[(2,4,6-trimethylphenyl)methoxy]oxane |
| SMILES | Cc1cc(C)c(CO[C@@H]2[C@H](OCc3c(C)cc(C)cc3C)[C@H](C)O[C@H](Sc3ccccc3)[C@H]2OCc2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C42H52O4S/c1-25-16-28(4)36(29(5)17-25)22-43-39-34(10)46-42(47-35-14-12-11-13-15-35)41(45-24-38-32(8)20-27(3)21-33(38)9)40(39)44-23-37-30(6)18-26(2)19-31(37)7/h11-21,34,39-42H,22-24H2,1-10H3/t34-,39+,40+,41-,42+/m0/s1 |
| InChIKey | JPLHRXOLRDNJIX-YPJIMGFCSA-N |
| XLogP | 10.06 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.94 |
| LogP ≤ 5 | 10.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |