C38H58FN7O4Si2 — CID 66733694
Tert-butyl 7-(bis((2-(trimethylsilyl)ethoxy)methyl)amino)-3-(6-fluoroquinolin-3-yl)pyrazolo[1,5-a]pyrimidin-5-yl(piperidin-4-ylmethyl)carbamate (PubChem CID 66733694) has the molecular formula C38H58FN7O4Si2 and a molecular weight of 752.10 g/mol. Its IUPAC name is tert-butyl N-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(6-fluoroquinolin-3-yl)pyrazolo[1,5-a]pyrimidin-5-yl]-N-(piperidin-4-ylmethyl)carbamate.
| Compound Name | Tert-butyl 7-(bis((2-(trimethylsilyl)ethoxy)methyl)amino)-3-(6-fluoroquinolin-3-yl)pyrazolo[1,5-a]pyrimidin-5-yl(piperidin-4-ylmethyl)carbamate |
|---|---|
| PubChem CID | 66733694 |
| Molecular Formula | C38H58FN7O4Si2 |
| Molecular Weight | 752.10 g/mol |
| Exact Mass | 751.41 |
| IUPAC Name | tert-butyl N-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(6-fluoroquinolin-3-yl)pyrazolo[1,5-a]pyrimidin-5-yl]-N-(piperidin-4-ylmethyl)carbamate |
| SMILES | CC(C)(C)OC(=O)N(CC1CCNCC1)C2=NC3=C(C=NN3C(=C2)N(COCC[Si](C)(C)C)COCC[Si](C)(C)C)C4=CN=C5C=CC(=CC5=C4)F |
| InChI | InChI=1S/C38H58FN7O4Si2/c1-38(2,3)50-37(47)45(25-28-12-14-40-15-13-28)34-22-35(44(26-48-16-18-51(4,5)6)27-49-17-19-52(7,8)9)46-36(43-34)32(24-42-46)30-20-29-21-31(39)10-11-33(29)41-23-30/h10-11,20-24,28,40H,12-19,25-27H2,1-9H3 |
| InChIKey | ZYCDQHFYENARLV-UHFFFAOYSA-N |
| XLogP | — |
| TPSA | 106.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 52 |
| Complexity | 1100 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|