About [3-[(1-amino-3,7-dihydro-2H-inden-5-yl)methyl]-5-(trifluoromethyl)phenyl]methanol
[3-[(1-amino-3,7-dihydro-2H-inden-5-yl)methyl]-5-(trifluoromethyl)phenyl]methanol (PubChem CID 66733861) has the molecular formula C18H18F3NO
and a molecular weight of 321.34 g/mol. Its IUPAC name is [3-[(1-amino-3,7-dihydro-2H-inden-5-yl)methyl]-5-(trifluoromethyl)phenyl]methanol.
Molecular Properties
| Compound Name | [3-[(1-amino-3,7-dihydro-2H-inden-5-yl)methyl]-5-(trifluoromethyl)phenyl]methanol |
| PubChem CID | 66733861 |
| Molecular Formula | C18H18F3NO |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | [3-[(1-amino-3,7-dihydro-2H-inden-5-yl)methyl]-5-(trifluoromethyl)phenyl]methanol |
| SMILES | NC1=C2CC=C(Cc3cc(CO)cc(C(F)(F)F)c3)C=C2CC1 |
| InChI | InChI=1S/C18H18F3NO/c19-18(20,21)15-8-12(6-13(9-15)10-23)5-11-1-3-16-14(7-11)2-4-17(16)22/h1,6-9,23H,2-5,10,22H2 |
| InChIKey | FCESNPIJECVSPG-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [3-[(1-amino-3,7-dihydro-2H-inden-5-yl)methyl]-5-(trifluoromethyl)phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[(1-amino-3,7-dihydro-2H-inden-5-yl)methyl]-5-(trifluoromethyl)phenyl]methanol?
The IUPAC name of [3-[(1-amino-3,7-dihydro-2H-inden-5-yl)methyl]-5-(trifluoromethyl)phenyl]methanol (CID 66733861) is [3-[(1-amino-3,7-dihydro-2H-inden-5-yl)methyl]-5-(trifluoromethyl)phenyl]methanol.
What is the SMILES notation for [3-[(1-amino-3,7-dihydro-2H-inden-5-yl)methyl]-5-(trifluoromethyl)phenyl]methanol?
The canonical SMILES for [3-[(1-amino-3,7-dihydro-2H-inden-5-yl)methyl]-5-(trifluoromethyl)phenyl]methanol is NC1=C2CC=C(Cc3cc(CO)cc(C(F)(F)F)c3)C=C2CC1.
What is the InChIKey of [3-[(1-amino-3,7-dihydro-2H-inden-5-yl)methyl]-5-(trifluoromethyl)phenyl]methanol?
The InChIKey is FCESNPIJECVSPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18F3NO/c19-18(20,21)15-8-12(6-13(9-15)10-23)5-11-1-3-16-14(7-11)2-4-17(16)22/h1,6-9,23H,2-5,10,22H2.
What are the key properties of [3-[(1-amino-3,7-dihydro-2H-inden-5-yl)methyl]-5-(trifluoromethyl)phenyl]methanol?
[3-[(1-amino-3,7-dihydro-2H-inden-5-yl)methyl]-5-(trifluoromethyl)phenyl]methanol has a molecular weight of 321.34 g/mol, XLogP of 4.00, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(1-amino-3,7-dihydro-2H-inden-5-yl)methyl]-5-(trifluoromethyl)phenyl]methanol is sourced from PubChem (CID 66733861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).