C12H16N2 — CID 66733867
(1R,8R)-1,2,3,6,7,8-hexahydro-as-indacene-1,8-diamine (PubChem CID 66733867) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is (1R,8R)-1,2,3,6,7,8-hexahydro-as-indacene-1,8-diamine.
| Compound Name | (1R,8R)-1,2,3,6,7,8-hexahydro-as-indacene-1,8-diamine |
|---|---|
| PubChem CID | 66733867 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | (1R,8R)-1,2,3,6,7,8-hexahydro-as-indacene-1,8-diamine |
| SMILES | N[C@@H]1CCc2ccc3c(c21)[C@H](N)CC3 |
| InChI | InChI=1S/C12H16N2/c13-9-5-3-7-1-2-8-4-6-10(14)12(8)11(7)9/h1-2,9-10H,3-6,13-14H2/t9-,10-/m1/s1 |
| InChIKey | XHCFXWDZGUKCCT-NXEZZACHSA-N |
| XLogP | 1.58 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |