C41H56FN7O4Si2 — CID 66733894
(1-benzylpiperidin-4-yl)methyl-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(6-fluoroquinolin-3-yl)pyrazolo[1,5-a]pyrimidin-5-yl]carbamic acid (PubChem CID 66733894) has the molecular formula C41H56FN7O4Si2 and a molecular weight of 786.11 g/mol. Its IUPAC name is (1-benzylpiperidin-4-yl)methyl-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(6-fluoroquinolin-3-yl)pyrazolo[1,5-a]pyrimidin-5-yl]carbamic acid.
| Compound Name | (1-benzylpiperidin-4-yl)methyl-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(6-fluoroquinolin-3-yl)pyrazolo[1,5-a]pyrimidin-5-yl]carbamic acid |
|---|---|
| PubChem CID | 66733894 |
| Molecular Formula | C41H56FN7O4Si2 |
| Molecular Weight | 786.11 g/mol |
| Exact Mass | 785.39 |
| IUPAC Name | (1-benzylpiperidin-4-yl)methyl-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(6-fluoroquinolin-3-yl)pyrazolo[1,5-a]pyrimidin-5-yl]carbamic acid |
| SMILES | C[Si](C)(C)CCOCN(COCC[Si](C)(C)C)c1cc(N(CC2CCN(Cc3ccccc3)CC2)C(=O)O)nc2c(-c3cnc4ccc(F)cc4c3)cnn12 |
| InChI | InChI=1S/C41H56FN7O4Si2/c1-54(2,3)20-18-52-29-47(30-53-19-21-55(4,5)6)39-24-38(48(41(50)51)28-32-14-16-46(17-15-32)27-31-10-8-7-9-11-31)45-40-36(26-44-49(39)40)34-22-33-23-35(42)12-13-37(33)43-25-34/h7-13,22-26,32H,14-21,27-30H2,1-6H3,(H,50,51) |
| InChIKey | KGCZDHFKPZAQPY-UHFFFAOYSA-N |
| XLogP | 8.91 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.11 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|