About cyclododecylmethanol;1,1-dimethoxycyclododecane
cyclododecylmethanol;1,1-dimethoxycyclododecane (PubChem CID 66734139) has the molecular formula C27H54O3
and a molecular weight of 426.73 g/mol. Its IUPAC name is cyclododecylmethanol;1,1-dimethoxycyclododecane.
Molecular Properties
| Compound Name | cyclododecylmethanol;1,1-dimethoxycyclododecane |
| PubChem CID | 66734139 |
| Molecular Formula | C27H54O3 |
| Molecular Weight | 426.73 g/mol |
| Exact Mass | 426.41 |
| IUPAC Name | cyclododecylmethanol;1,1-dimethoxycyclododecane |
| SMILES | COC1(OC)CCCCCCCCCCC1.OCC1CCCCCCCCCCC1 |
| InChI | InChI=1S/C14H28O2.C13H26O/c1-15-14(16-2)12-10-8-6-4-3-5-7-9-11-13-14;14-12-13-10-8-6-4-2-1-3-5-7-9-11-13/h3-13H2,1-2H3;13-14H,1-12H2 |
| InChIKey | UESYBBCFUSIXFQ-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 426.73 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze cyclododecylmethanol;1,1-dimethoxycyclododecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclododecylmethanol;1,1-dimethoxycyclododecane?
The IUPAC name of cyclododecylmethanol;1,1-dimethoxycyclododecane (CID 66734139) is cyclododecylmethanol;1,1-dimethoxycyclododecane.
What is the SMILES notation for cyclododecylmethanol;1,1-dimethoxycyclododecane?
The canonical SMILES for cyclododecylmethanol;1,1-dimethoxycyclododecane is COC1(OC)CCCCCCCCCCC1.OCC1CCCCCCCCCCC1.
What is the InChIKey of cyclododecylmethanol;1,1-dimethoxycyclododecane?
The InChIKey is UESYBBCFUSIXFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28O2.C13H26O/c1-15-14(16-2)12-10-8-6-4-3-5-7-9-11-13-14;14-12-13-10-8-6-4-2-1-3-5-7-9-11-13/h3-13H2,1-2H3;13-14H,1-12H2.
What are the key properties of cyclododecylmethanol;1,1-dimethoxycyclododecane?
cyclododecylmethanol;1,1-dimethoxycyclododecane has a molecular weight of 426.73 g/mol, XLogP of 8.18, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclododecylmethanol;1,1-dimethoxycyclododecane is sourced from PubChem (CID 66734139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).