C16H25BN2O3S — CID 66734173
4-[[4-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1,3-thiazol-2-yl]methyl]morpholine (PubChem CID 66734173) has the molecular formula C16H25BN2O3S and a molecular weight of 336.27 g/mol. Its IUPAC name is 4-[[4-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1,3-thiazol-2-yl]methyl]morpholine.
| Compound Name | 4-[[4-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1,3-thiazol-2-yl]methyl]morpholine |
|---|---|
| PubChem CID | 66734173 |
| Molecular Formula | C16H25BN2O3S |
| Molecular Weight | 336.27 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | 4-[[4-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1,3-thiazol-2-yl]methyl]morpholine |
| SMILES | CC1(C)OB(C=Cc2csc(CN3CCOCC3)n2)OC1(C)C |
| InChI | InChI=1S/C16H25BN2O3S/c1-15(2)16(3,4)22-17(21-15)6-5-13-12-23-14(18-13)11-19-7-9-20-10-8-19/h5-6,12H,7-11H2,1-4H3 |
| InChIKey | GBJOZZIBLUTLQE-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 43.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.27 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|