C34H40N4O2Si — CID 66734193
2'-[3-[(E)-2-[4-[(dimethylamino)methyl]phenyl]ethenyl]-1-(2-trimethylsilylethoxymethyl)indazol-6-yl]spiro[1H-indole-3,1'-cyclopropane]-2-one (PubChem CID 66734193) has the molecular formula C34H40N4O2Si and a molecular weight of 564.81 g/mol. Its IUPAC name is 2'-[3-[(E)-2-[4-[(dimethylamino)methyl]phenyl]ethenyl]-1-(2-trimethylsilylethoxymethyl)indazol-6-yl]spiro[1H-indole-3,1'-cyclopropane]-2-one.
| Compound Name | 2'-[3-[(E)-2-[4-[(dimethylamino)methyl]phenyl]ethenyl]-1-(2-trimethylsilylethoxymethyl)indazol-6-yl]spiro[1H-indole-3,1'-cyclopropane]-2-one |
|---|---|
| PubChem CID | 66734193 |
| Molecular Formula | C34H40N4O2Si |
| Molecular Weight | 564.81 g/mol |
| Exact Mass | 564.29 |
| IUPAC Name | 2'-[3-[(E)-2-[4-[(dimethylamino)methyl]phenyl]ethenyl]-1-(2-trimethylsilylethoxymethyl)indazol-6-yl]spiro[1H-indole-3,1'-cyclopropane]-2-one |
| SMILES | CN(C)Cc1ccc(/C=C/c2nn(COCC[Si](C)(C)C)c3cc(C4CC45C(=O)Nc4ccccc45)ccc23)cc1 |
| InChI | InChI=1S/C34H40N4O2Si/c1-37(2)22-25-12-10-24(11-13-25)14-17-30-27-16-15-26(20-32(27)38(36-30)23-40-18-19-41(3,4)5)29-21-34(29)28-8-6-7-9-31(28)35-33(34)39/h6-17,20,29H,18-19,21-23H2,1-5H3,(H,35,39)/b17-14+ |
| InChIKey | UASKQPSNEAPEGD-SAPNQHFASA-N |
| XLogP | 6.96 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.81 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|