About 4-pentyl-3,4-dihydro-1H-pyrimidin-2-one
4-pentyl-3,4-dihydro-1H-pyrimidin-2-one (PubChem CID 66734873) has the molecular formula C9H16N2O
and a molecular weight of 168.24 g/mol. Its IUPAC name is 4-pentyl-3,4-dihydro-1H-pyrimidin-2-one.
Molecular Properties
| Compound Name | 4-pentyl-3,4-dihydro-1H-pyrimidin-2-one |
| PubChem CID | 66734873 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | 4-pentyl-3,4-dihydro-1H-pyrimidin-2-one |
| SMILES | CCCCCC1C=CNC(=O)N1 |
| InChI | InChI=1S/C9H16N2O/c1-2-3-4-5-8-6-7-10-9(12)11-8/h6-8H,2-5H2,1H3,(H2,10,11,12) |
| InChIKey | SMUYNDNFYFXLAL-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-pentyl-3,4-dihydro-1H-pyrimidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-pentyl-3,4-dihydro-1H-pyrimidin-2-one?
The IUPAC name of 4-pentyl-3,4-dihydro-1H-pyrimidin-2-one (CID 66734873) is 4-pentyl-3,4-dihydro-1H-pyrimidin-2-one.
What is the SMILES notation for 4-pentyl-3,4-dihydro-1H-pyrimidin-2-one?
The canonical SMILES for 4-pentyl-3,4-dihydro-1H-pyrimidin-2-one is CCCCCC1C=CNC(=O)N1.
What is the InChIKey of 4-pentyl-3,4-dihydro-1H-pyrimidin-2-one?
The InChIKey is SMUYNDNFYFXLAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2O/c1-2-3-4-5-8-6-7-10-9(12)11-8/h6-8H,2-5H2,1H3,(H2,10,11,12).
What are the key properties of 4-pentyl-3,4-dihydro-1H-pyrimidin-2-one?
4-pentyl-3,4-dihydro-1H-pyrimidin-2-one has a molecular weight of 168.24 g/mol, XLogP of 1.76, 4 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-pentyl-3,4-dihydro-1H-pyrimidin-2-one is sourced from PubChem (CID 66734873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).