C14H20O4 — CID 66735400
trans-(1R,2R)-1,2-bis(prop-2-enyl)cyclohexane-1,2-dicarboxylic acid (PubChem CID 66735400) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is trans-(1R,2R)-1,2-bis(prop-2-enyl)cyclohexane-1,2-dicarboxylic acid.
| Compound Name | trans-(1R,2R)-1,2-bis(prop-2-enyl)cyclohexane-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 66735400 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | trans-(1R,2R)-1,2-bis(prop-2-enyl)cyclohexane-1,2-dicarboxylic acid |
| SMILES | C=CC[C@]1(C(=O)O)CCCC[C@]1(CC=C)C(=O)O |
| InChI | InChI=1S/C14H20O4/c1-3-7-13(11(15)16)9-5-6-10-14(13,8-4-2)12(17)18/h3-4H,1-2,5-10H2,(H,15,16)(H,17,18)/t13-,14-/m1/s1 |
| InChIKey | WABVBCWVHCTXKG-ZIAGYGMSSA-N |
| XLogP | 2.85 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|