About 1H-imidazol-3-ium acetate
1H-imidazol-3-ium acetate (PubChem CID 66735416) has the molecular formula C5H8N2O2
and a molecular weight of 128.13 g/mol. Its IUPAC name is 1H-imidazol-3-ium acetate.
Molecular Properties
| Compound Name | 1H-imidazol-3-ium acetate |
| PubChem CID | 66735416 |
| Molecular Formula | C5H8N2O2 |
| Molecular Weight | 128.13 g/mol |
| Exact Mass | 128.06 |
| IUPAC Name | 1H-imidazol-3-ium acetate |
| SMILES | CC(=O)[O-].c1c[nH+]c[nH]1 |
| InChI | InChI=1S/C3H4N2.C2H4O2/c1-2-5-3-4-1;1-2(3)4/h1-3H,(H,4,5);1H3,(H,3,4) |
| InChIKey | OFGDSGVGRWPQJQ-UHFFFAOYSA-N |
| XLogP | -1.41 |
| TPSA | 70.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.13 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1H-imidazol-3-ium acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-imidazol-3-ium acetate?
The IUPAC name of 1H-imidazol-3-ium acetate (CID 66735416) is 1H-imidazol-3-ium acetate.
What is the SMILES notation for 1H-imidazol-3-ium acetate?
The canonical SMILES for 1H-imidazol-3-ium acetate is CC(=O)[O-].c1c[nH+]c[nH]1.
What is the InChIKey of 1H-imidazol-3-ium acetate?
The InChIKey is OFGDSGVGRWPQJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4N2.C2H4O2/c1-2-5-3-4-1;1-2(3)4/h1-3H,(H,4,5);1H3,(H,3,4).
What are the key properties of 1H-imidazol-3-ium acetate?
1H-imidazol-3-ium acetate has a molecular weight of 128.13 g/mol, XLogP of -1.41, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-imidazol-3-ium acetate is sourced from PubChem (CID 66735416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).