C17H33N3O2 — CID 66735578
(1,5-dipentyl-1,3,5-triazinan-2-yl)methyl prop-2-enoate (PubChem CID 66735578) has the molecular formula C17H33N3O2 and a molecular weight of 311.47 g/mol. Its IUPAC name is (1,5-dipentyl-1,3,5-triazinan-2-yl)methyl prop-2-enoate.
| Compound Name | (1,5-dipentyl-1,3,5-triazinan-2-yl)methyl prop-2-enoate |
|---|---|
| PubChem CID | 66735578 |
| Molecular Formula | C17H33N3O2 |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.26 |
| IUPAC Name | (1,5-dipentyl-1,3,5-triazinan-2-yl)methyl prop-2-enoate |
| SMILES | C=CC(=O)OCC1NCN(CCCCC)CN1CCCCC |
| InChI | InChI=1S/C17H33N3O2/c1-4-7-9-11-19-14-18-16(13-22-17(21)6-3)20(15-19)12-10-8-5-2/h6,16,18H,3-5,7-15H2,1-2H3 |
| InChIKey | BIHDIAQEWGOSEH-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|