C17H10Cl2F3NO2 — CID 66735591
4-[(E)-3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-2-enoyl]benzamide (PubChem CID 66735591) has the molecular formula C17H10Cl2F3NO2 and a molecular weight of 388.17 g/mol. Its IUPAC name is 4-[(E)-3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-2-enoyl]benzamide.
| Compound Name | 4-[(E)-3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-2-enoyl]benzamide |
|---|---|
| PubChem CID | 66735591 |
| Molecular Formula | C17H10Cl2F3NO2 |
| Molecular Weight | 388.17 g/mol |
| Exact Mass | 387.00 |
| IUPAC Name | 4-[(E)-3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-2-enoyl]benzamide |
| SMILES | NC(=O)c1ccc(C(=O)/C=C(\c2cc(Cl)cc(Cl)c2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H10Cl2F3NO2/c18-12-5-11(6-13(19)7-12)14(17(20,21)22)8-15(24)9-1-3-10(4-2-9)16(23)25/h1-8H,(H2,23,25)/b14-8+ |
| InChIKey | KJTKTANNWRNBPJ-RIYZIHGNSA-N |
| XLogP | 4.92 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.17 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|