C34H45N5O5SSi2 — CID 66735928
5-(4-methylsulfonylphenoxy)-3-quinolin-3-yl-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine (PubChem CID 66735928) has the molecular formula C34H45N5O5SSi2 and a molecular weight of 692.00 g/mol. Its IUPAC name is 5-(4-methylsulfonylphenoxy)-3-quinolin-3-yl-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 5-(4-methylsulfonylphenoxy)-3-quinolin-3-yl-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 66735928 |
| Molecular Formula | C34H45N5O5SSi2 |
| Molecular Weight | 692.00 g/mol |
| Exact Mass | 691.27 |
| IUPAC Name | 5-(4-methylsulfonylphenoxy)-3-quinolin-3-yl-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine |
| SMILES | C[Si](C)(C)CCOCN(COCC[Si](C)(C)C)c1cc(Oc2ccc(S(C)(=O)=O)cc2)nc2c(-c3cnc4ccccc4c3)cnn12 |
| InChI | InChI=1S/C34H45N5O5SSi2/c1-45(40,41)29-14-12-28(13-15-29)44-32-21-33(38(24-42-16-18-46(2,3)4)25-43-17-19-47(5,6)7)39-34(37-32)30(23-36-39)27-20-26-10-8-9-11-31(26)35-22-27/h8-15,20-23H,16-19,24-25H2,1-7H3 |
| InChIKey | KZWLNNSAIZEYPT-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 108.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.00 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|