C19H25NO5Si — CID 66736524
3-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-(3-hydroxy-5-trimethylsilylpent-4-ynyl)-1,3-oxazolidin-2-one (PubChem CID 66736524) has the molecular formula C19H25NO5Si and a molecular weight of 375.50 g/mol. Its IUPAC name is 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-(3-hydroxy-5-trimethylsilylpent-4-ynyl)-1,3-oxazolidin-2-one.
| Compound Name | 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-(3-hydroxy-5-trimethylsilylpent-4-ynyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 66736524 |
| Molecular Formula | C19H25NO5Si |
| Molecular Weight | 375.50 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-(3-hydroxy-5-trimethylsilylpent-4-ynyl)-1,3-oxazolidin-2-one |
| SMILES | C[Si](C)(C)C#CC(O)CCC1CN(c2ccc3c(c2)OCCO3)C(=O)O1 |
| InChI | InChI=1S/C19H25NO5Si/c1-26(2,3)11-8-15(21)5-6-16-13-20(19(22)25-16)14-4-7-17-18(12-14)24-10-9-23-17/h4,7,12,15-16,21H,5-6,9-10,13H2,1-3H3 |
| InChIKey | SUIUGXPHLTYVED-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.50 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|