C33H41N11O2 — CID 66736654
(1R,2S,3R,5S)-3-[2-[3-(dimethylamino)pyrrolidin-1-yl]-6-(2,2-diphenylethylamino)purin-9-yl]-5-(5-ethyltetrazol-2-yl)cyclopentane-1,2-diol (PubChem CID 66736654) has the molecular formula C33H41N11O2 and a molecular weight of 623.77 g/mol. Its IUPAC name is (1R,2S,3R,5S)-3-[2-[3-(dimethylamino)pyrrolidin-1-yl]-6-(2,2-diphenylethylamino)purin-9-yl]-5-(5-ethyltetrazol-2-yl)cyclopentane-1,2-diol.
| Compound Name | (1R,2S,3R,5S)-3-[2-[3-(dimethylamino)pyrrolidin-1-yl]-6-(2,2-diphenylethylamino)purin-9-yl]-5-(5-ethyltetrazol-2-yl)cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 66736654 |
| Molecular Formula | C33H41N11O2 |
| Molecular Weight | 623.77 g/mol |
| Exact Mass | 623.34 |
| IUPAC Name | (1R,2S,3R,5S)-3-[2-[3-(dimethylamino)pyrrolidin-1-yl]-6-(2,2-diphenylethylamino)purin-9-yl]-5-(5-ethyltetrazol-2-yl)cyclopentane-1,2-diol |
| SMILES | CCc1nnn([C@H]2C[C@@H](n3cnc4c(NCC(c5ccccc5)c5ccccc5)nc(N5CCC(N(C)C)C5)nc43)[C@H](O)[C@@H]2O)n1 |
| InChI | InChI=1S/C33H41N11O2/c1-4-27-38-40-44(39-27)26-17-25(29(45)30(26)46)43-20-35-28-31(36-33(37-32(28)43)42-16-15-23(19-42)41(2)3)34-18-24(21-11-7-5-8-12-21)22-13-9-6-10-14-22/h5-14,20,23-26,29-30,45-46H,4,15-19H2,1-3H3,(H,34,36,37)/t23?,25-,26+,29+,30-/m1/s1 |
| InChIKey | JYQCKYPUTJELNJ-JNMNEJCRSA-N |
| XLogP | 2.67 |
| TPSA | 146.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.77 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |