C25H24N2O6 — CID 66737251
(5R)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-[4-(6-methoxyquinolin-4-yl)oxybut-2-enyl]-1,3-oxazolidin-2-one (PubChem CID 66737251) has the molecular formula C25H24N2O6 and a molecular weight of 448.48 g/mol. Its IUPAC name is (5R)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-[4-(6-methoxyquinolin-4-yl)oxybut-2-enyl]-1,3-oxazolidin-2-one.
| Compound Name | (5R)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-[4-(6-methoxyquinolin-4-yl)oxybut-2-enyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 66737251 |
| Molecular Formula | C25H24N2O6 |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | (5R)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-[4-(6-methoxyquinolin-4-yl)oxybut-2-enyl]-1,3-oxazolidin-2-one |
| SMILES | COc1ccc2nccc(OCC=CC[C@@H]3CN(c4ccc5c(c4)OCCO5)C(=O)O3)c2c1 |
| InChI | InChI=1S/C25H24N2O6/c1-29-18-6-7-21-20(15-18)22(9-10-26-21)30-11-3-2-4-19-16-27(25(28)33-19)17-5-8-23-24(14-17)32-13-12-31-23/h2-3,5-10,14-15,19H,4,11-13,16H2,1H3/t19-/m1/s1 |
| InChIKey | PUVYNLFFOUUZCT-LJQANCHMSA-N |
| XLogP | 4.37 |
| TPSA | 79.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|