C20H26Cl2N4O2 — CID 66737897
1-[4-[4-[(3,4-dichlorophenyl)methyl]piperazin-1-yl]butyl]-5-methylpyrimidine-2,4-dione (PubChem CID 66737897) has the molecular formula C20H26Cl2N4O2 and a molecular weight of 425.36 g/mol. Its IUPAC name is 1-[4-[4-[(3,4-dichlorophenyl)methyl]piperazin-1-yl]butyl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[4-[4-[(3,4-dichlorophenyl)methyl]piperazin-1-yl]butyl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 66737897 |
| Molecular Formula | C20H26Cl2N4O2 |
| Molecular Weight | 425.36 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | 1-[4-[4-[(3,4-dichlorophenyl)methyl]piperazin-1-yl]butyl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn(CCCCN2CCN(Cc3ccc(Cl)c(Cl)c3)CC2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C20H26Cl2N4O2/c1-15-13-26(20(28)23-19(15)27)7-3-2-6-24-8-10-25(11-9-24)14-16-4-5-17(21)18(22)12-16/h4-5,12-13H,2-3,6-11,14H2,1H3,(H,23,27,28) |
| InChIKey | RAFQYIJCMSTJBG-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 61.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.36 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|