About N-(furan-2-ylmethyl)-3,4-dimethoxy-N-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]benzamide
N-(furan-2-ylmethyl)-3,4-dimethoxy-N-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]benzamide (PubChem CID 667379) has the molecular formula C25H24N2O5
and a molecular weight of 432.48 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-3,4-dimethoxy-N-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]benzamide.
Molecular Properties
| Compound Name | N-(furan-2-ylmethyl)-3,4-dimethoxy-N-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]benzamide |
| PubChem CID | 667379 |
| Molecular Formula | C25H24N2O5 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | N-(furan-2-ylmethyl)-3,4-dimethoxy-N-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]benzamide |
| SMILES | COc1ccc(C(=O)N(Cc2ccco2)Cc2cc3cc(C)ccc3[nH]c2=O)cc1OC |
| InChI | InChI=1S/C25H24N2O5/c1-16-6-8-21-18(11-16)12-19(24(28)26-21)14-27(15-20-5-4-10-32-20)25(29)17-7-9-22(30-2)23(13-17)31-3/h4-13H,14-15H2,1-3H3,(H,26,28) |
| InChIKey | ZGZQCWZPCJQFIT-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 84.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(furan-2-ylmethyl)-3,4-dimethoxy-N-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(furan-2-ylmethyl)-3,4-dimethoxy-N-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]benzamide?
The IUPAC name of N-(furan-2-ylmethyl)-3,4-dimethoxy-N-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]benzamide (CID 667379) is N-(furan-2-ylmethyl)-3,4-dimethoxy-N-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]benzamide.
What is the SMILES notation for N-(furan-2-ylmethyl)-3,4-dimethoxy-N-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]benzamide?
The canonical SMILES for N-(furan-2-ylmethyl)-3,4-dimethoxy-N-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]benzamide is COc1ccc(C(=O)N(Cc2ccco2)Cc2cc3cc(C)ccc3[nH]c2=O)cc1OC.
What is the InChIKey of N-(furan-2-ylmethyl)-3,4-dimethoxy-N-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]benzamide?
The InChIKey is ZGZQCWZPCJQFIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H24N2O5/c1-16-6-8-21-18(11-16)12-19(24(28)26-21)14-27(15-20-5-4-10-32-20)25(29)17-7-9-22(30-2)23(13-17)31-3/h4-13H,14-15H2,1-3H3,(H,26,28).
What are the key properties of N-(furan-2-ylmethyl)-3,4-dimethoxy-N-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]benzamide?
N-(furan-2-ylmethyl)-3,4-dimethoxy-N-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]benzamide has a molecular weight of 432.48 g/mol, XLogP of 4.29, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(furan-2-ylmethyl)-3,4-dimethoxy-N-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]benzamide is sourced from PubChem (CID 667379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).