C13H17NO4 — CID 66738003
(2R,3S,4S)-2-(hydroxymethyl)oxolane-3,4-diol;1H-indole (PubChem CID 66738003) has the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. Its IUPAC name is (2R,3S,4S)-2-(hydroxymethyl)oxolane-3,4-diol;1H-indole.
| Compound Name | (2R,3S,4S)-2-(hydroxymethyl)oxolane-3,4-diol;1H-indole |
|---|---|
| PubChem CID | 66738003 |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | (2R,3S,4S)-2-(hydroxymethyl)oxolane-3,4-diol;1H-indole |
| SMILES | OC[C@H]1OC[C@H](O)[C@@H]1O.c1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C8H7N.C5H10O4/c1-2-4-8-7(3-1)5-6-9-8;6-1-4-5(8)3(7)2-9-4/h1-6,9H;3-8H,1-2H2/t;3-,4+,5-/m.0/s1 |
| InChIKey | HXGWJDHANWBJKO-HEEXEHOYSA-N |
| XLogP | 0.27 |
| TPSA | 85.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |