C27H30FNO3 — CID 66738030
(3R,4R,5R)-1-benzyl-3-(fluoromethyl)-4,5-bis(phenylmethoxy)piperidin-4-ol (PubChem CID 66738030) has the molecular formula C27H30FNO3 and a molecular weight of 435.54 g/mol. Its IUPAC name is (3R,4R,5R)-1-benzyl-3-(fluoromethyl)-4,5-bis(phenylmethoxy)piperidin-4-ol.
| Compound Name | (3R,4R,5R)-1-benzyl-3-(fluoromethyl)-4,5-bis(phenylmethoxy)piperidin-4-ol |
|---|---|
| PubChem CID | 66738030 |
| Molecular Formula | C27H30FNO3 |
| Molecular Weight | 435.54 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | (3R,4R,5R)-1-benzyl-3-(fluoromethyl)-4,5-bis(phenylmethoxy)piperidin-4-ol |
| SMILES | O[C@@]1(OCc2ccccc2)[C@H](CF)CN(Cc2ccccc2)C[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C27H30FNO3/c28-16-25-18-29(17-22-10-4-1-5-11-22)19-26(31-20-23-12-6-2-7-13-23)27(25,30)32-21-24-14-8-3-9-15-24/h1-15,25-26,30H,16-21H2/t25-,26-,27-/m1/s1 |
| InChIKey | LSARUTMGLFQDAH-ZONZVBGPSA-N |
| XLogP | 4.58 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.54 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|